C23H15F9N2O4 — CID 163405278
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-oxo-1-[2-(2,2,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 163405278) has the molecular formula C23H15F9N2O4 and a molecular weight of 554.37 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-oxo-1-[2-(2,2,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-oxo-1-[2-(2,2,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163405278 |
| Molecular Formula | C23H15F9N2O4 |
| Molecular Weight | 554.37 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-oxo-1-[2-(2,2,2-trifluoroethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)c1cccn(-c2ccccc2OCC(F)(F)F)c1=O |
| InChI | InChI=1S/C23H15F9N2O4/c24-20(25,26)12-38-17-6-2-1-5-16(17)34-11-3-4-15(19(34)36)18(35)33-14-9-7-13(8-10-14)21(37,22(27,28)29)23(30,31)32/h1-11,37H,12H2,(H,33,35) |
| InChIKey | VPWOIVBPNLHCRW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |