About 3,3-dipentoxybutan-2-one
3,3-dipentoxybutan-2-one (PubChem CID 163406006) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is 3,3-dipentoxybutan-2-one.
Molecular Properties
| Compound Name | 3,3-dipentoxybutan-2-one |
| PubChem CID | 163406006 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 3,3-dipentoxybutan-2-one |
| SMILES | CCCCCOC(C)(OCCCCC)C(C)=O |
| InChI | InChI=1S/C14H28O3/c1-5-7-9-11-16-14(4,13(3)15)17-12-10-8-6-2/h5-12H2,1-4H3 |
| InChIKey | RWMIOBPJMLOPPB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dipentoxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dipentoxybutan-2-one?
The IUPAC name of 3,3-dipentoxybutan-2-one (CID 163406006) is 3,3-dipentoxybutan-2-one.
What is the SMILES notation for 3,3-dipentoxybutan-2-one?
The canonical SMILES for 3,3-dipentoxybutan-2-one is CCCCCOC(C)(OCCCCC)C(C)=O.
What is the InChIKey of 3,3-dipentoxybutan-2-one?
The InChIKey is RWMIOBPJMLOPPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3/c1-5-7-9-11-16-14(4,13(3)15)17-12-10-8-6-2/h5-12H2,1-4H3.
What are the key properties of 3,3-dipentoxybutan-2-one?
3,3-dipentoxybutan-2-one has a molecular weight of 244.37 g/mol, XLogP of 3.71, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dipentoxybutan-2-one is sourced from PubChem (CID 163406006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).