C18H29ClN2O — CID 163406015
1-tert-butyl-4-[(4-chloro-3-propan-2-yloxyphenyl)methyl]piperazine (PubChem CID 163406015) has the molecular formula C18H29ClN2O and a molecular weight of 324.90 g/mol. Its IUPAC name is 1-tert-butyl-4-[(4-chloro-3-propan-2-yloxyphenyl)methyl]piperazine.
| Compound Name | 1-tert-butyl-4-[(4-chloro-3-propan-2-yloxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 163406015 |
| Molecular Formula | C18H29ClN2O |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-tert-butyl-4-[(4-chloro-3-propan-2-yloxyphenyl)methyl]piperazine |
| SMILES | CC(C)Oc1cc(CN2CCN(C(C)(C)C)CC2)ccc1Cl |
| InChI | InChI=1S/C18H29ClN2O/c1-14(2)22-17-12-15(6-7-16(17)19)13-20-8-10-21(11-9-20)18(3,4)5/h6-7,12,14H,8-11,13H2,1-5H3 |
| InChIKey | JVKUQKAPXPNPBF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |