C13H28O12P4 — CID 163406125
3,9-bis(2-dimethoxyphosphorylethyl)-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide (PubChem CID 163406125) has the molecular formula C13H28O12P4 and a molecular weight of 500.25 g/mol. Its IUPAC name is 3,9-bis(2-dimethoxyphosphorylethyl)-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide.
| Compound Name | 3,9-bis(2-dimethoxyphosphorylethyl)-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide |
|---|---|
| PubChem CID | 163406125 |
| Molecular Formula | C13H28O12P4 |
| Molecular Weight | 500.25 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 3,9-bis(2-dimethoxyphosphorylethyl)-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide |
| SMILES | COP(=O)(CCP1(=O)OCC2(CO1)COP(=O)(CCP(=O)(OC)OC)OC2)OC |
| InChI | InChI=1S/C13H28O12P4/c1-18-26(14,19-2)5-7-28(16)22-9-13(10-23-28)11-24-29(17,25-12-13)8-6-27(15,20-3)21-4/h5-12H2,1-4H3 |
| InChIKey | VCWVFXKZUBZBDS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|