C25H24O3 — CID 163406270
(2,6-dimethyl-10-phenoxy-1,2,3,4-tetrahydroanthracen-9-yl) prop-2-enoate (PubChem CID 163406270) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is (2,6-dimethyl-10-phenoxy-1,2,3,4-tetrahydroanthracen-9-yl) prop-2-enoate.
| Compound Name | (2,6-dimethyl-10-phenoxy-1,2,3,4-tetrahydroanthracen-9-yl) prop-2-enoate |
|---|---|
| PubChem CID | 163406270 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (2,6-dimethyl-10-phenoxy-1,2,3,4-tetrahydroanthracen-9-yl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2c(c(Oc3ccccc3)c3cc(C)ccc13)CCC(C)C2 |
| InChI | InChI=1S/C25H24O3/c1-4-23(26)28-25-20-13-11-16(2)14-21(20)24(27-18-8-6-5-7-9-18)19-12-10-17(3)15-22(19)25/h4-9,11,13-14,17H,1,10,12,15H2,2-3H3 |
| InChIKey | JVGOCNZNGBQHSI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|