C26H25ClO5 — CID 163406349
[7-chloro-10-methoxycarbonyloxy-14-(4-methylpent-3-enyl)-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl] prop-2-enoate (PubChem CID 163406349) has the molecular formula C26H25ClO5 and a molecular weight of 452.93 g/mol. Its IUPAC name is [7-chloro-10-methoxycarbonyloxy-14-(4-methylpent-3-enyl)-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl] prop-2-enoate.
| Compound Name | [7-chloro-10-methoxycarbonyloxy-14-(4-methylpent-3-enyl)-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl] prop-2-enoate |
|---|---|
| PubChem CID | 163406349 |
| Molecular Formula | C26H25ClO5 |
| Molecular Weight | 452.93 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [7-chloro-10-methoxycarbonyloxy-14-(4-methylpent-3-enyl)-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2c(c(OC(=O)OC)c3cc(Cl)ccc13)C1C=C(CCC=C(C)C)C2C1 |
| InChI | InChI=1S/C26H25ClO5/c1-5-21(28)31-24-18-10-9-17(27)13-20(18)25(32-26(29)30-4)22-16-11-15(8-6-7-14(2)3)19(12-16)23(22)24/h5,7,9-11,13,16,19H,1,6,8,12H2,2-4H3 |
| InChIKey | HSJQFDQMBJRYSL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.93 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|