C21H17ClO4 — CID 163406364
(10-acetyloxy-7-chloro-14-methyl-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate (PubChem CID 163406364) has the molecular formula C21H17ClO4 and a molecular weight of 368.82 g/mol. Its IUPAC name is (10-acetyloxy-7-chloro-14-methyl-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate.
| Compound Name | (10-acetyloxy-7-chloro-14-methyl-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate |
|---|---|
| PubChem CID | 163406364 |
| Molecular Formula | C21H17ClO4 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (10-acetyloxy-7-chloro-14-methyl-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2c(c(OC(C)=O)c3cc(Cl)ccc13)C1C=C(C)C2C1 |
| InChI | InChI=1S/C21H17ClO4/c1-4-17(24)26-20-14-6-5-13(22)9-16(14)21(25-11(3)23)18-12-7-10(2)15(8-12)19(18)20/h4-7,9,12,15H,1,8H2,2-3H3 |
| InChIKey | RSOHUSQMYHHRKN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|