C26H20O4 — CID 163406763
(2,4-diphenoxynaphthalen-1-yl) 2-methylprop-2-enoate (PubChem CID 163406763) has the molecular formula C26H20O4 and a molecular weight of 396.44 g/mol. Its IUPAC name is (2,4-diphenoxynaphthalen-1-yl) 2-methylprop-2-enoate.
| Compound Name | (2,4-diphenoxynaphthalen-1-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163406763 |
| Molecular Formula | C26H20O4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (2,4-diphenoxynaphthalen-1-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(Oc2ccccc2)cc(Oc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C26H20O4/c1-18(2)26(27)30-25-22-16-10-9-15-21(22)23(28-19-11-5-3-6-12-19)17-24(25)29-20-13-7-4-8-14-20/h3-17H,1H2,2H3 |
| InChIKey | HKFFCSMHCCJIQK-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|