C24H28O3 — CID 163407018
[10-hydroxy-6-methyl-2-(4-methylpent-3-enyl)-1,2,3,4-tetrahydroanthracen-9-yl] prop-2-enoate (PubChem CID 163407018) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is [10-hydroxy-6-methyl-2-(4-methylpent-3-enyl)-1,2,3,4-tetrahydroanthracen-9-yl] prop-2-enoate.
| Compound Name | [10-hydroxy-6-methyl-2-(4-methylpent-3-enyl)-1,2,3,4-tetrahydroanthracen-9-yl] prop-2-enoate |
|---|---|
| PubChem CID | 163407018 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [10-hydroxy-6-methyl-2-(4-methylpent-3-enyl)-1,2,3,4-tetrahydroanthracen-9-yl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2c(c(O)c3cc(C)ccc13)CCC(CCC=C(C)C)C2 |
| InChI | InChI=1S/C24H28O3/c1-5-22(25)27-24-19-11-9-16(4)13-20(19)23(26)18-12-10-17(14-21(18)24)8-6-7-15(2)3/h5,7,9,11,13,17,26H,1,6,8,10,12,14H2,2-4H3 |
| InChIKey | LXYVRUWDRUVJLQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|