About (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile
(5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile (PubChem CID 163407658) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile.
Molecular Properties
| Compound Name | (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile |
| PubChem CID | 163407658 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile |
| SMILES | CC1C[C@]2(CCN(C#N)C2)C(=O)N1 |
| InChI | InChI=1S/C9H13N3O/c1-7-4-9(8(13)11-7)2-3-12(5-9)6-10/h7H,2-5H2,1H3,(H,11,13)/t7?,9-/m0/s1 |
| InChIKey | QJSGPSYFYHOZNH-NETXQHHPSA-N |
| XLogP | 0.07 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile?
The IUPAC name of (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile (CID 163407658) is (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile.
What is the SMILES notation for (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile?
The canonical SMILES for (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile is CC1C[C@]2(CCN(C#N)C2)C(=O)N1.
What is the InChIKey of (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile?
The InChIKey is QJSGPSYFYHOZNH-NETXQHHPSA-N. The full InChI is InChI=1S/C9H13N3O/c1-7-4-9(8(13)11-7)2-3-12(5-9)6-10/h7H,2-5H2,1H3,(H,11,13)/t7?,9-/m0/s1.
What are the key properties of (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile?
(5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile has a molecular weight of 179.22 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile is sourced from PubChem (CID 163407658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).