C19H19N5O2 — CID 163407700
7-(6-methoxy-2-methyl-3-pyridinyl)-2-oxospiro[1,4-dihydro-1,5-naphthyridine-3,3'-pyrrolidine]-1'-carbonitrile (PubChem CID 163407700) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 7-(6-methoxy-2-methyl-3-pyridinyl)-2-oxospiro[1,4-dihydro-1,5-naphthyridine-3,3'-pyrrolidine]-1'-carbonitrile.
| Compound Name | 7-(6-methoxy-2-methyl-3-pyridinyl)-2-oxospiro[1,4-dihydro-1,5-naphthyridine-3,3'-pyrrolidine]-1'-carbonitrile |
|---|---|
| PubChem CID | 163407700 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 7-(6-methoxy-2-methyl-3-pyridinyl)-2-oxospiro[1,4-dihydro-1,5-naphthyridine-3,3'-pyrrolidine]-1'-carbonitrile |
| SMILES | COc1ccc(-c2cnc3c(c2)NC(=O)C2(CCN(C#N)C2)C3)c(C)n1 |
| InChI | InChI=1S/C19H19N5O2/c1-12-14(3-4-17(22-12)26-2)13-7-15-16(21-9-13)8-19(18(25)23-15)5-6-24(10-19)11-20/h3-4,7,9H,5-6,8,10H2,1-2H3,(H,23,25) |
| InChIKey | NBWHXOTYTBBNGA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|