C22H20N4OS — CID 163408064
3-[3-(1,3-benzothiazol-6-yl)-5-oxo-2,3,4,4a,6,7,8,8a-octahydro-1H-1,8-naphthyridin-2-yl]benzonitrile (PubChem CID 163408064) has the molecular formula C22H20N4OS and a molecular weight of 388.50 g/mol. Its IUPAC name is 3-[3-(1,3-benzothiazol-6-yl)-5-oxo-2,3,4,4a,6,7,8,8a-octahydro-1H-1,8-naphthyridin-2-yl]benzonitrile.
| Compound Name | 3-[3-(1,3-benzothiazol-6-yl)-5-oxo-2,3,4,4a,6,7,8,8a-octahydro-1H-1,8-naphthyridin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 163408064 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3-[3-(1,3-benzothiazol-6-yl)-5-oxo-2,3,4,4a,6,7,8,8a-octahydro-1H-1,8-naphthyridin-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(C2NC3NCCC(=O)C3CC2c2ccc3ncsc3c2)c1 |
| InChI | InChI=1S/C22H20N4OS/c23-11-13-2-1-3-15(8-13)21-16(10-17-19(27)6-7-24-22(17)26-21)14-4-5-18-20(9-14)28-12-25-18/h1-5,8-9,12,16-17,21-22,24,26H,6-7,10H2 |
| InChIKey | MUEANFKCXFXYBK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |