C10H3F15O5 — CID 163408228
[1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxy-4-(trifluoromethyl)pent-2-en-2-yl] hydrogen carbonate (PubChem CID 163408228) has the molecular formula C10H3F15O5 and a molecular weight of 488.10 g/mol. Its IUPAC name is [1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxy-4-(trifluoromethyl)pent-2-en-2-yl] hydrogen carbonate.
| Compound Name | [1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxy-4-(trifluoromethyl)pent-2-en-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 163408228 |
| Molecular Formula | C10H3F15O5 |
| Molecular Weight | 488.10 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | [1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxy-4-(trifluoromethyl)pent-2-en-2-yl] hydrogen carbonate |
| SMILES | O=C(O)OC(=C(C(O)(C(F)(F)F)C(F)(F)F)C(O)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H3F15O5/c11-6(12,13)2(30-3(26)27)1(4(28,7(14,15)16)8(17,18)19)5(29,9(20,21)22)10(23,24)25/h28-29H,(H,26,27) |
| InChIKey | OCHPDPULPJVESI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.10 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|