C7H10N2S — CID 163408563
3-thiophen-2-ylprop-2-ene-1,2-diamine (PubChem CID 163408563) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is 3-thiophen-2-ylprop-2-ene-1,2-diamine.
| Compound Name | 3-thiophen-2-ylprop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 163408563 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3-thiophen-2-ylprop-2-ene-1,2-diamine |
| SMILES | NCC(N)=Cc1cccs1 |
| InChI | InChI=1S/C7H10N2S/c8-5-6(9)4-7-2-1-3-10-7/h1-4H,5,8-9H2 |
| InChIKey | WFLLEGJOWOVAOH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |