C12H11N5O4 — CID 163408619
3-amino-1-[(2-hydroxyphenyl)methyl]-7,9-dihydropurine-2,6,8-trione (PubChem CID 163408619) has the molecular formula C12H11N5O4 and a molecular weight of 289.25 g/mol. Its IUPAC name is 3-amino-1-[(2-hydroxyphenyl)methyl]-7,9-dihydropurine-2,6,8-trione.
| Compound Name | 3-amino-1-[(2-hydroxyphenyl)methyl]-7,9-dihydropurine-2,6,8-trione |
|---|---|
| PubChem CID | 163408619 |
| Molecular Formula | C12H11N5O4 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 3-amino-1-[(2-hydroxyphenyl)methyl]-7,9-dihydropurine-2,6,8-trione |
| SMILES | Nn1c(=O)n(Cc2ccccc2O)c(=O)c2[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C12H11N5O4/c13-17-9-8(14-11(20)15-9)10(19)16(12(17)21)5-6-3-1-2-4-7(6)18/h1-4,18H,5,13H2,(H2,14,15,20) |
| InChIKey | ZYEZRMHWFMTENI-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 138.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|