About (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate
(2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate (PubChem CID 163408995) has the molecular formula C11H15NO2
and a molecular weight of 196.26 g/mol. Its IUPAC name is (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate.
Molecular Properties
| Compound Name | (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate |
| PubChem CID | 163408995 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate |
| SMILES | [2H]C([2H])([2H])NC(=O)Oc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C11H15NO2/c1-7-5-8(2)9(3)10(6-7)14-11(13)12-4/h5-6H,1-4H3,(H,12,13)/i4D3 |
| InChIKey | NYOKZHDTNBDPOB-GKOSEXJESA-N |
| XLogP | 2.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate?
The IUPAC name of (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate (CID 163408995) is (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate.
What is the SMILES notation for (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate?
The canonical SMILES for (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate is [2H]C([2H])([2H])NC(=O)Oc1cc(C)cc(C)c1C.
What is the InChIKey of (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate?
The InChIKey is NYOKZHDTNBDPOB-GKOSEXJESA-N. The full InChI is InChI=1S/C11H15NO2/c1-7-5-8(2)9(3)10(6-7)14-11(13)12-4/h5-6H,1-4H3,(H,12,13)/i4D3.
What are the key properties of (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate?
(2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate has a molecular weight of 196.26 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,5-trimethylphenyl) N-(trideuteriomethyl)carbamate is sourced from PubChem (CID 163408995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).