C16H23FO5S — CID 163409523
(2S,3R,4S,5R,6R)-2-(4-fluorophenyl)sulfanyl-3,4,5-trimethoxy-6-(methoxymethyl)oxane (PubChem CID 163409523) has the molecular formula C16H23FO5S and a molecular weight of 346.42 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-(4-fluorophenyl)sulfanyl-3,4,5-trimethoxy-6-(methoxymethyl)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-(4-fluorophenyl)sulfanyl-3,4,5-trimethoxy-6-(methoxymethyl)oxane |
|---|---|
| PubChem CID | 163409523 |
| Molecular Formula | C16H23FO5S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-(4-fluorophenyl)sulfanyl-3,4,5-trimethoxy-6-(methoxymethyl)oxane |
| SMILES | COC[C@H]1O[C@@H](Sc2ccc(F)cc2)[C@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C16H23FO5S/c1-18-9-12-13(19-2)14(20-3)15(21-4)16(22-12)23-11-7-5-10(17)6-8-11/h5-8,12-16H,9H2,1-4H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | UQVVTRLVVQTAIU-LJIZCISZSA-N |
| XLogP | 2.33 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |