About 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone
2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone (PubChem CID 163409796) has the molecular formula C5H6ClFO
and a molecular weight of 136.55 g/mol. Its IUPAC name is 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone.
Molecular Properties
| Compound Name | 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone |
| PubChem CID | 163409796 |
| Molecular Formula | C5H6ClFO |
| Molecular Weight | 136.55 g/mol |
| Exact Mass | 136.01 |
| IUPAC Name | 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone |
| SMILES | O=C(CCl)[C@H]1C[C@H]1F |
| InChI | InChI=1S/C5H6ClFO/c6-2-5(8)3-1-4(3)7/h3-4H,1-2H2/t3-,4+/m0/s1 |
| InChIKey | NMMRTNVBZMZWLU-IUYQGCFVSA-N |
| XLogP | 1.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.55 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone?
The IUPAC name of 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone (CID 163409796) is 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone.
What is the SMILES notation for 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone?
The canonical SMILES for 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone is O=C(CCl)[C@H]1C[C@H]1F.
What is the InChIKey of 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone?
The InChIKey is NMMRTNVBZMZWLU-IUYQGCFVSA-N. The full InChI is InChI=1S/C5H6ClFO/c6-2-5(8)3-1-4(3)7/h3-4H,1-2H2/t3-,4+/m0/s1.
What are the key properties of 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone?
2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone has a molecular weight of 136.55 g/mol, XLogP of 1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone is sourced from PubChem (CID 163409796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).