C17H34NO8P — CID 163410136
2-[[(2R)-3-butanoyloxy-2-octanoyloxypropoxy]-hydroxyphosphoryl]oxyethylazanium (PubChem CID 163410136) has the molecular formula C17H34NO8P and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-[[(2R)-3-butanoyloxy-2-octanoyloxypropoxy]-hydroxyphosphoryl]oxyethylazanium.
| Compound Name | 2-[[(2R)-3-butanoyloxy-2-octanoyloxypropoxy]-hydroxyphosphoryl]oxyethylazanium |
|---|---|
| PubChem CID | 163410136 |
| Molecular Formula | C17H34NO8P |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-[[(2R)-3-butanoyloxy-2-octanoyloxypropoxy]-hydroxyphosphoryl]oxyethylazanium |
| SMILES | [CH2-]CCC(=O)OC[C@H](COP(=O)(O)OCC[NH3+])OC(=O)CCCCCCC |
| InChI | InChI=1S/C17H33NO8P/c1-3-5-6-7-8-10-17(20)26-15(13-23-16(19)9-4-2)14-25-27(21,22)24-12-11-18/h15H,2-14,18H2,1H3,(H,21,22)/q-1/p+1/t15-/m1/s1 |
| InChIKey | PWZOITAYZHOCOT-OAHLLOKOSA-O |
| XLogP | 1.79 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|