C24H36O5 — CID 163410199
(4R)-4-[(3R,7R,8S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 163410199) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is (4R)-4-[(3R,7R,8S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(3R,7R,8S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 163410199 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (4R)-4-[(3R,7R,8S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@H]3C(=C[C@H](O)[C@]12C)[C@@]1(C)CC[C@@H](O)C=C1C[C@H]3O |
| InChI | InChI=1S/C24H36O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h10,12-13,15-17,19-20,22,25-27H,4-9,11H2,1-3H3,(H,28,29)/t13-,15-,16-,17+,19-,20+,22+,23+,24-/m1/s1 |
| InChIKey | ICXAAPJWFWMSFV-BAFUWZGRSA-N |
| XLogP | 3.29 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|