C13H17BNO6S- — CID 163410297
2-[(3R)-2,2-dihydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1-oxa-2-boranuidacyclohept-6-en-7-yl]acetic acid (PubChem CID 163410297) has the molecular formula C13H17BNO6S- and a molecular weight of 326.16 g/mol. Its IUPAC name is 2-[(3R)-2,2-dihydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1-oxa-2-boranuidacyclohept-6-en-7-yl]acetic acid.
| Compound Name | 2-[(3R)-2,2-dihydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1-oxa-2-boranuidacyclohept-6-en-7-yl]acetic acid |
|---|---|
| PubChem CID | 163410297 |
| Molecular Formula | C13H17BNO6S- |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[(3R)-2,2-dihydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1-oxa-2-boranuidacyclohept-6-en-7-yl]acetic acid |
| SMILES | O=C(O)CC1=CCC[C@H](NC(=O)Cc2cccs2)[B-](O)(O)O1 |
| InChI | InChI=1S/C13H17BNO6S/c16-12(8-10-4-2-6-22-10)15-11-5-1-3-9(7-13(17)18)21-14(11,19)20/h2-4,6,11,19-20H,1,5,7-8H2,(H,15,16)(H,17,18)/q-1/t11-/m0/s1 |
| InChIKey | VMYSRMZASQESAI-NSHDSACASA-N |
| XLogP | 0.41 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|