C29H26F3N3O4S — CID 163411645
N,N,2-trimethyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxamide (PubChem CID 163411645) has the molecular formula C29H26F3N3O4S and a molecular weight of 569.61 g/mol. Its IUPAC name is N,N,2-trimethyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxamide.
| Compound Name | N,N,2-trimethyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxamide |
|---|---|
| PubChem CID | 163411645 |
| Molecular Formula | C29H26F3N3O4S |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | N,N,2-trimethyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxamide |
| SMILES | CN(C)C(=O)C1CN(C)S(=O)(=O)c2c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)cc(=O)n21 |
| InChI | InChI=1S/C29H26F3N3O4S/c1-33(2)27(37)24-17-34(3)40(38,39)28-26(20-11-7-12-22(15-20)29(30,31)32)21(16-25(36)35(24)28)14-19-10-6-9-18-8-4-5-13-23(18)19/h4-13,15-16,24H,14,17H2,1-3H3 |
| InChIKey | AAZRHEUUXMCYIV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |