C12H16N2O6 — CID 163411992
[(2E,4Z)-6-(methylamino)-6-oxohexa-2,4-dien-3-yl] 2-hydroxy-1-oxido-5-oxopyrrolidin-1-ium-1-carboxylate (PubChem CID 163411992) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is [(2E,4Z)-6-(methylamino)-6-oxohexa-2,4-dien-3-yl] 2-hydroxy-1-oxido-5-oxopyrrolidin-1-ium-1-carboxylate.
| Compound Name | [(2E,4Z)-6-(methylamino)-6-oxohexa-2,4-dien-3-yl] 2-hydroxy-1-oxido-5-oxopyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 163411992 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | [(2E,4Z)-6-(methylamino)-6-oxohexa-2,4-dien-3-yl] 2-hydroxy-1-oxido-5-oxopyrrolidin-1-ium-1-carboxylate |
| SMILES | C/C=C(\C=C/C(=O)NC)OC(=O)[N+]1([O-])C(=O)CCC1O |
| InChI | InChI=1S/C12H16N2O6/c1-3-8(4-5-9(15)13-2)20-12(18)14(19)10(16)6-7-11(14)17/h3-5,10,16H,6-7H2,1-2H3,(H,13,15)/b5-4-,8-3+ |
| InChIKey | ABGZKSOQWIHXPS-UEQFWHKLSA-N |
| XLogP | 0.28 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|