About 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene
1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene (PubChem CID 163413517) has the molecular formula C14H20ClNO2
and a molecular weight of 269.77 g/mol. Its IUPAC name is 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene.
Molecular Properties
| Compound Name | 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene |
| PubChem CID | 163413517 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene |
| SMILES | CCCc1c(C)c(Cl)c(CCC)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H20ClNO2/c1-5-7-11-9(3)13(15)12(8-6-2)14(10(11)4)16(17)18/h5-8H2,1-4H3 |
| InChIKey | ACMGVSZRWKXSHT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene?
The IUPAC name of 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene (CID 163413517) is 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene.
What is the SMILES notation for 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene?
The canonical SMILES for 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene is CCCc1c(C)c(Cl)c(CCC)c([N+](=O)[O-])c1C.
What is the InChIKey of 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene?
The InChIKey is ACMGVSZRWKXSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO2/c1-5-7-11-9(3)13(15)12(8-6-2)14(10(11)4)16(17)18/h5-8H2,1-4H3.
What are the key properties of 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene?
1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene has a molecular weight of 269.77 g/mol, XLogP of 4.77, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,4-dimethyl-5-nitro-3,6-dipropylbenzene is sourced from PubChem (CID 163413517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).