C20H27N3O — CID 163414083
6-(6-methyl-4-piperidin-1-yl-3,4,4a,5-tetrahydro-1H-quinazolin-2-ylidene)cyclohex-2-en-1-one (PubChem CID 163414083) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 6-(6-methyl-4-piperidin-1-yl-3,4,4a,5-tetrahydro-1H-quinazolin-2-ylidene)cyclohex-2-en-1-one.
| Compound Name | 6-(6-methyl-4-piperidin-1-yl-3,4,4a,5-tetrahydro-1H-quinazolin-2-ylidene)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163414083 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 6-(6-methyl-4-piperidin-1-yl-3,4,4a,5-tetrahydro-1H-quinazolin-2-ylidene)cyclohex-2-en-1-one |
| SMILES | CC1=CC=C2NC(=C3CCC=CC3=O)NC(N3CCCCC3)C2C1 |
| InChI | InChI=1S/C20H27N3O/c1-14-9-10-17-16(13-14)20(23-11-5-2-6-12-23)22-19(21-17)15-7-3-4-8-18(15)24/h4,8-10,16,20-22H,2-3,5-7,11-13H2,1H3 |
| InChIKey | UQAHJBLDRHNNKW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|