C33H37ClN5O4S+ — CID 163415099
[4-[4-[6-[carboxy-[(2-methylpropan-2-yl)oxy]methyl]-7-(4-chlorophenyl)-5-methyl-1,3-benzothiazol-2-yl]-2-formylpiperazin-2-yl]-2-methanimidoylphenyl]-methylazanium (PubChem CID 163415099) has the molecular formula C33H37ClN5O4S+ and a molecular weight of 635.21 g/mol. Its IUPAC name is [4-[4-[6-[carboxy-[(2-methylpropan-2-yl)oxy]methyl]-7-(4-chlorophenyl)-5-methyl-1,3-benzothiazol-2-yl]-2-formylpiperazin-2-yl]-2-methanimidoylphenyl]-methylazanium.
| Compound Name | [4-[4-[6-[carboxy-[(2-methylpropan-2-yl)oxy]methyl]-7-(4-chlorophenyl)-5-methyl-1,3-benzothiazol-2-yl]-2-formylpiperazin-2-yl]-2-methanimidoylphenyl]-methylazanium |
|---|---|
| PubChem CID | 163415099 |
| Molecular Formula | C33H37ClN5O4S+ |
| Molecular Weight | 635.21 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | [4-[4-[6-[carboxy-[(2-methylpropan-2-yl)oxy]methyl]-7-(4-chlorophenyl)-5-methyl-1,3-benzothiazol-2-yl]-2-formylpiperazin-2-yl]-2-methanimidoylphenyl]-methylazanium |
| SMILES | [H]/N=C/c1cc(C2(C=O)CN(c3nc4cc(C)c(C(OC(C)(C)C)C(=O)O)c(-c5ccc(Cl)cc5)c4s3)CCN2)ccc1[NH2+]C |
| InChI | InChI=1S/C33H36ClN5O4S/c1-19-14-25-29(27(20-6-9-23(34)10-7-20)26(19)28(30(41)42)43-32(2,3)4)44-31(38-25)39-13-12-37-33(17-39,18-40)22-8-11-24(36-5)21(15-22)16-35/h6-11,14-16,18,28,35-37H,12-13,17H2,1-5H3,(H,41,42)/p+1/b35-16+ |
| InChIKey | ADSMQMAYFZPQAE-QNVXDBMFSA-O |
| XLogP | 5.19 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.21 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|