C18H23ClN4O2 — CID 163415264
6-chloro-3-[2-(4-ethylpiperazin-1-yl)ethyliminomethyl]-4-hydroxy-1H-quinolin-2-one (PubChem CID 163415264) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is 6-chloro-3-[2-(4-ethylpiperazin-1-yl)ethyliminomethyl]-4-hydroxy-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[2-(4-ethylpiperazin-1-yl)ethyliminomethyl]-4-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 163415264 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 6-chloro-3-[2-(4-ethylpiperazin-1-yl)ethyliminomethyl]-4-hydroxy-1H-quinolin-2-one |
| SMILES | CCN1CCN(CC/N=C/c2c(O)c3cc(Cl)ccc3[nH]c2=O)CC1 |
| InChI | InChI=1S/C18H23ClN4O2/c1-2-22-7-9-23(10-8-22)6-5-20-12-15-17(24)14-11-13(19)3-4-16(14)21-18(15)25/h3-4,11-12H,2,5-10H2,1H3,(H2,21,24,25)/b20-12+ |
| InChIKey | QZZWOBSTZTXKQJ-UDWIEESQSA-N |
| XLogP | 1.94 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|