C20H17N2O3S2- — CID 163415422
4-[4-(benzylcarbamothioylamino)phenoxy]benzenesulfinate (PubChem CID 163415422) has the molecular formula C20H17N2O3S2- and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[4-(benzylcarbamothioylamino)phenoxy]benzenesulfinate.
| Compound Name | 4-[4-(benzylcarbamothioylamino)phenoxy]benzenesulfinate |
|---|---|
| PubChem CID | 163415422 |
| Molecular Formula | C20H17N2O3S2- |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-[4-(benzylcarbamothioylamino)phenoxy]benzenesulfinate |
| SMILES | O=S([O-])c1ccc(Oc2ccc(NC(=S)NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O3S2/c23-27(24)19-12-10-18(11-13-19)25-17-8-6-16(7-9-17)22-20(26)21-14-15-4-2-1-3-5-15/h1-13H,14H2,(H,23,24)(H2,21,22,26)/p-1 |
| InChIKey | BTUGYLYRFSOFOQ-UHFFFAOYSA-M |
| XLogP | 4.20 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|