About 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine
4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine (PubChem CID 163415756) has the molecular formula C9H15N4O-
and a molecular weight of 195.25 g/mol. Its IUPAC name is 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine |
| PubChem CID | 163415756 |
| Molecular Formula | C9H15N4O- |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine |
| SMILES | Nc1ccc(CCCN(N)[O-])cc1N |
| InChI | InChI=1S/C9H15N4O/c10-8-4-3-7(6-9(8)11)2-1-5-13(12)14/h3-4,6H,1-2,5,10-12H2/q-1 |
| InChIKey | UQIFROXHOYTJSK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine?
The IUPAC name of 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine (CID 163415756) is 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine.
What is the SMILES notation for 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine?
The canonical SMILES for 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine is Nc1ccc(CCCN(N)[O-])cc1N.
What is the InChIKey of 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine?
The InChIKey is UQIFROXHOYTJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N4O/c10-8-4-3-7(6-9(8)11)2-1-5-13(12)14/h3-4,6H,1-2,5,10-12H2/q-1.
What are the key properties of 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine?
4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine has a molecular weight of 195.25 g/mol, XLogP of 0.46, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[amino(oxido)amino]propyl]benzene-1,2-diamine is sourced from PubChem (CID 163415756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).