C28H21ClN4 — CID 163416253
2-(4-chloro-4-methyl-6-phenyl-1H-1,3,5-triazin-2-yl)-9-phenylcarbazole (PubChem CID 163416253) has the molecular formula C28H21ClN4 and a molecular weight of 448.96 g/mol. Its IUPAC name is 2-(4-chloro-4-methyl-6-phenyl-1H-1,3,5-triazin-2-yl)-9-phenylcarbazole.
| Compound Name | 2-(4-chloro-4-methyl-6-phenyl-1H-1,3,5-triazin-2-yl)-9-phenylcarbazole |
|---|---|
| PubChem CID | 163416253 |
| Molecular Formula | C28H21ClN4 |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-(4-chloro-4-methyl-6-phenyl-1H-1,3,5-triazin-2-yl)-9-phenylcarbazole |
| SMILES | CC1(Cl)N=C(c2ccccc2)NC(c2ccc3c4ccccc4n(-c4ccccc4)c3c2)=N1 |
| InChI | InChI=1S/C28H21ClN4/c1-28(29)31-26(19-10-4-2-5-11-19)30-27(32-28)20-16-17-23-22-14-8-9-15-24(22)33(25(23)18-20)21-12-6-3-7-13-21/h2-18H,1H3,(H,30,31,32) |
| InChIKey | AERAGIIRQKHXKQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|