C11H21NO — CID 163416832
2-(buta-2,3-dienoxymethyl)-N-ethylbutan-1-amine (PubChem CID 163416832) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 2-(buta-2,3-dienoxymethyl)-N-ethylbutan-1-amine.
| Compound Name | 2-(buta-2,3-dienoxymethyl)-N-ethylbutan-1-amine |
|---|---|
| PubChem CID | 163416832 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-(buta-2,3-dienoxymethyl)-N-ethylbutan-1-amine |
| SMILES | C=C=CCOCC(CC)CNCC |
| InChI | InChI=1S/C11H21NO/c1-4-7-8-13-10-11(5-2)9-12-6-3/h7,11-12H,1,5-6,8-10H2,2-3H3 |
| InChIKey | AFCUXKSJQJCZJX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|