About 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol
2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol (PubChem CID 163417097) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol.
Molecular Properties
| Compound Name | 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol |
| PubChem CID | 163417097 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol |
| SMILES | COC1C(C)C(OC)C(C(C)O)C1O |
| InChI | InChI=1S/C10H20O4/c1-5-9(13-3)7(6(2)11)8(12)10(5)14-4/h5-12H,1-4H3 |
| InChIKey | AFIMQZXYOMFNQV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol?
The IUPAC name of 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol (CID 163417097) is 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol.
What is the SMILES notation for 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol?
The canonical SMILES for 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol is COC1C(C)C(OC)C(C(C)O)C1O.
What is the InChIKey of 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol?
The InChIKey is AFIMQZXYOMFNQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-5-9(13-3)7(6(2)11)8(12)10(5)14-4/h5-12H,1-4H3.
What are the key properties of 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol?
2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol has a molecular weight of 204.27 g/mol, XLogP of 0.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxyethyl)-3,5-dimethoxy-4-methylcyclopentan-1-ol is sourced from PubChem (CID 163417097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).