C13H17F2NO3 — CID 163417473
2,2-difluoro-4-(3-methoxypropyl)-6-methyl-4a,8a-dihydro-1,4-benzoxazin-3-one (PubChem CID 163417473) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is 2,2-difluoro-4-(3-methoxypropyl)-6-methyl-4a,8a-dihydro-1,4-benzoxazin-3-one.
| Compound Name | 2,2-difluoro-4-(3-methoxypropyl)-6-methyl-4a,8a-dihydro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 163417473 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2,2-difluoro-4-(3-methoxypropyl)-6-methyl-4a,8a-dihydro-1,4-benzoxazin-3-one |
| SMILES | COCCCN1C(=O)C(F)(F)OC2C=CC(C)=CC21 |
| InChI | InChI=1S/C13H17F2NO3/c1-9-4-5-11-10(8-9)16(6-3-7-18-2)12(17)13(14,15)19-11/h4-5,8,10-11H,3,6-7H2,1-2H3 |
| InChIKey | AFQUTCYYQMDNNN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|