C20H24N4 — CID 163417498
(2Z,3Z)-2-[5-[(1Z)-1-[(5Z)-5-(3-iminobutan-2-ylidene)pyrrol-2-ylidene]ethyl]pyrrol-2-ylidene]hexa-3,5-dien-3-amine (PubChem CID 163417498) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is (2Z,3Z)-2-[5-[(1Z)-1-[(5Z)-5-(3-iminobutan-2-ylidene)pyrrol-2-ylidene]ethyl]pyrrol-2-ylidene]hexa-3,5-dien-3-amine.
| Compound Name | (2Z,3Z)-2-[5-[(1Z)-1-[(5Z)-5-(3-iminobutan-2-ylidene)pyrrol-2-ylidene]ethyl]pyrrol-2-ylidene]hexa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 163417498 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (2Z,3Z)-2-[5-[(1Z)-1-[(5Z)-5-(3-iminobutan-2-ylidene)pyrrol-2-ylidene]ethyl]pyrrol-2-ylidene]hexa-3,5-dien-3-amine |
| SMILES | [H]/N=C(C)/C(C)=c1/cc/c(=C(\C)C2=N/C(=C(C)\C(N)=C\C=C)C=C2)[nH]1 |
| InChI | InChI=1S/C20H24N4/c1-6-7-16(22)13(3)18-9-11-20(24-18)14(4)19-10-8-17(23-19)12(2)15(5)21/h6-11,21,23H,1,22H2,2-5H3/b16-7-,17-12-,18-13-,19-14-,21-15+ |
| InChIKey | AFRQAHDCNVCZLE-JWONUVFRSA-N |
| XLogP | 2.71 |
| TPSA | 78.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|