C19H31FN4O — CID 163418713
(2,2-diethyl-4-fluoropyrrolidin-1-yl)-[(5S)-2,5,7,7-tetramethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone (PubChem CID 163418713) has the molecular formula C19H31FN4O and a molecular weight of 350.48 g/mol. Its IUPAC name is (2,2-diethyl-4-fluoropyrrolidin-1-yl)-[(5S)-2,5,7,7-tetramethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone.
| Compound Name | (2,2-diethyl-4-fluoropyrrolidin-1-yl)-[(5S)-2,5,7,7-tetramethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone |
|---|---|
| PubChem CID | 163418713 |
| Molecular Formula | C19H31FN4O |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (2,2-diethyl-4-fluoropyrrolidin-1-yl)-[(5S)-2,5,7,7-tetramethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone |
| SMILES | CCC1(CC)CC(F)CN1C(=O)c1c(C)nn2c1N[C@@H](C)CC2(C)C |
| InChI | InChI=1S/C19H31FN4O/c1-7-19(8-2)10-14(20)11-23(19)17(25)15-13(4)22-24-16(15)21-12(3)9-18(24,5)6/h12,14,21H,7-11H2,1-6H3/t12-,14?/m0/s1 |
| InChIKey | AGQIGLXWTWHMMR-NBFOIZRFSA-N |
| XLogP | 3.87 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |