C14H10F3N7O2 — CID 163419283
N'-hydroxy-5-[[5-[5-(trifluoromethyl)-2-pyridinyl]-1,3-oxazol-2-yl]amino]pyrimidine-2-carboximidamide (PubChem CID 163419283) has the molecular formula C14H10F3N7O2 and a molecular weight of 365.28 g/mol. Its IUPAC name is N'-hydroxy-5-[[5-[5-(trifluoromethyl)-2-pyridinyl]-1,3-oxazol-2-yl]amino]pyrimidine-2-carboximidamide.
| Compound Name | N'-hydroxy-5-[[5-[5-(trifluoromethyl)-2-pyridinyl]-1,3-oxazol-2-yl]amino]pyrimidine-2-carboximidamide |
|---|---|
| PubChem CID | 163419283 |
| Molecular Formula | C14H10F3N7O2 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N'-hydroxy-5-[[5-[5-(trifluoromethyl)-2-pyridinyl]-1,3-oxazol-2-yl]amino]pyrimidine-2-carboximidamide |
| SMILES | N/C(=N/O)c1ncc(Nc2ncc(-c3ccc(C(F)(F)F)cn3)o2)cn1 |
| InChI | InChI=1S/C14H10F3N7O2/c15-14(16,17)7-1-2-9(19-3-7)10-6-22-13(26-10)23-8-4-20-12(21-5-8)11(18)24-25/h1-6,25H,(H2,18,24)(H,22,23) |
| InChIKey | AHAVQXMGJUWHHI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|