About 1-ethyl-3-methanidylcyclopentane;uranium
1-ethyl-3-methanidylcyclopentane;uranium (PubChem CID 163419703) has the molecular formula C8H14U2-2
and a molecular weight of 586.26 g/mol. Its IUPAC name is 1-ethyl-3-methanidylcyclopentane;uranium.
Molecular Properties
| Compound Name | 1-ethyl-3-methanidylcyclopentane;uranium |
| PubChem CID | 163419703 |
| Molecular Formula | C8H14U2-2 |
| Molecular Weight | 586.26 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 1-ethyl-3-methanidylcyclopentane;uranium |
| SMILES | [CH2-]CC1CCC([CH2-])C1.[U].[U] |
| InChI | InChI=1S/C8H14.2U/c1-3-8-5-4-7(2)6-8;;/h7-8H,1-6H2;;/q-2;; |
| InChIKey | KZBNZNQBOMQMBR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 586.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methanidylcyclopentane;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methanidylcyclopentane;uranium?
The IUPAC name of 1-ethyl-3-methanidylcyclopentane;uranium (CID 163419703) is 1-ethyl-3-methanidylcyclopentane;uranium.
What is the SMILES notation for 1-ethyl-3-methanidylcyclopentane;uranium?
The canonical SMILES for 1-ethyl-3-methanidylcyclopentane;uranium is [CH2-]CC1CCC([CH2-])C1.[U].[U].
What is the InChIKey of 1-ethyl-3-methanidylcyclopentane;uranium?
The InChIKey is KZBNZNQBOMQMBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14.2U/c1-3-8-5-4-7(2)6-8;;/h7-8H,1-6H2;;/q-2;;.
What are the key properties of 1-ethyl-3-methanidylcyclopentane;uranium?
1-ethyl-3-methanidylcyclopentane;uranium has a molecular weight of 586.26 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methanidylcyclopentane;uranium is sourced from PubChem (CID 163419703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).