C29H51N3O3 — CID 163420021
(4S)-8-[4-(3,3-dimethyl-2-oxobutoxy)-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-1-yl]-4-(2,2-dimethylpropyl)-2,2-dimethyloctan-3-one (PubChem CID 163420021) has the molecular formula C29H51N3O3 and a molecular weight of 489.75 g/mol. Its IUPAC name is (4S)-8-[4-(3,3-dimethyl-2-oxobutoxy)-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-1-yl]-4-(2,2-dimethylpropyl)-2,2-dimethyloctan-3-one.
| Compound Name | (4S)-8-[4-(3,3-dimethyl-2-oxobutoxy)-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-1-yl]-4-(2,2-dimethylpropyl)-2,2-dimethyloctan-3-one |
|---|---|
| PubChem CID | 163420021 |
| Molecular Formula | C29H51N3O3 |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 489.39 |
| IUPAC Name | (4S)-8-[4-(3,3-dimethyl-2-oxobutoxy)-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-1-yl]-4-(2,2-dimethylpropyl)-2,2-dimethyloctan-3-one |
| SMILES | CC(C)(C)C[C@H](CCCCn1nnc2c1CCCCCC2OCC(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C29H51N3O3/c1-27(2,3)19-21(26(34)29(7,8)9)15-13-14-18-32-22-16-11-10-12-17-23(25(22)30-31-32)35-20-24(33)28(4,5)6/h21,23H,10-20H2,1-9H3/t21-,23?/m0/s1 |
| InChIKey | DFPPQAUNHJGRCD-BBQAJUCSSA-N |
| XLogP | 6.91 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|