C35H53N3O6 — CID 163420303
(3S,5R)-N-cyclopropyl-N-[4-(2-ethoxyethyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-6-yl]-3-[5-(ethoxymethyl)-7-methyloctanoyl]-2,3,4,5-tetrahydropyridine-5-carboxamide (PubChem CID 163420303) has the molecular formula C35H53N3O6 and a molecular weight of 611.82 g/mol. Its IUPAC name is (3S,5R)-N-cyclopropyl-N-[4-(2-ethoxyethyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-6-yl]-3-[5-(ethoxymethyl)-7-methyloctanoyl]-2,3,4,5-tetrahydropyridine-5-carboxamide.
| Compound Name | (3S,5R)-N-cyclopropyl-N-[4-(2-ethoxyethyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-6-yl]-3-[5-(ethoxymethyl)-7-methyloctanoyl]-2,3,4,5-tetrahydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 163420303 |
| Molecular Formula | C35H53N3O6 |
| Molecular Weight | 611.82 g/mol |
| Exact Mass | 611.39 |
| IUPAC Name | (3S,5R)-N-cyclopropyl-N-[4-(2-ethoxyethyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-6-yl]-3-[5-(ethoxymethyl)-7-methyloctanoyl]-2,3,4,5-tetrahydropyridine-5-carboxamide |
| SMILES | CCOCCN1C(=O)C(C)(C)Oc2ccc(N(C(=O)[C@H]3C=NC[C@@H](C(=O)CCCC(COCC)CC(C)C)C3)C3CC3)cc21 |
| InChI | InChI=1S/C35H53N3O6/c1-7-42-17-16-37-30-20-29(14-15-32(30)44-35(5,6)34(37)41)38(28-12-13-28)33(40)27-19-26(21-36-22-27)31(39)11-9-10-25(18-24(3)4)23-43-8-2/h14-15,20,22,24-28H,7-13,16-19,21,23H2,1-6H3/t25?,26-,27+/m0/s1 |
| InChIKey | AHXAPZYFDDSHDY-GDRMZMBQSA-N |
| XLogP | 5.87 |
| TPSA | 97.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.82 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|