C16H19Cl2N3O2 — CID 163420569
(2S)-2-[(2S)-butan-2-yl]-4-[N-(3,4-dichloroanilino)-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one (PubChem CID 163420569) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is (2S)-2-[(2S)-butan-2-yl]-4-[N-(3,4-dichloroanilino)-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one.
| Compound Name | (2S)-2-[(2S)-butan-2-yl]-4-[N-(3,4-dichloroanilino)-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 163420569 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (2S)-2-[(2S)-butan-2-yl]-4-[N-(3,4-dichloroanilino)-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)C(C(C)=NNc2ccc(Cl)c(Cl)c2)=C1O |
| InChI | InChI=1S/C16H19Cl2N3O2/c1-4-8(2)14-15(22)13(16(23)19-14)9(3)20-21-10-5-6-11(17)12(18)7-10/h5-8,14,21-22H,4H2,1-3H3,(H,19,23)/t8-,14-/m0/s1 |
| InChIKey | BUBRPPKIYIUHQR-RTHLEPHNSA-N |
| XLogP | 4.14 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|