C17H15F3O — CID 163420629
4-[4-(3,4,5-trifluorophenyl)phenyl]oxane (PubChem CID 163420629) has the molecular formula C17H15F3O and a molecular weight of 292.30 g/mol. Its IUPAC name is 4-[4-(3,4,5-trifluorophenyl)phenyl]oxane.
| Compound Name | 4-[4-(3,4,5-trifluorophenyl)phenyl]oxane |
|---|---|
| PubChem CID | 163420629 |
| Molecular Formula | C17H15F3O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-[4-(3,4,5-trifluorophenyl)phenyl]oxane |
| SMILES | Fc1cc(-c2ccc(C3CCOCC3)cc2)cc(F)c1F |
| InChI | InChI=1S/C17H15F3O/c18-15-9-14(10-16(19)17(15)20)12-3-1-11(2-4-12)13-5-7-21-8-6-13/h1-4,9-10,13H,5-8H2 |
| InChIKey | AICUBULBATUFQH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|