C19H24F6N2O3S — CID 163421218
N-[[(1R,3R)-3-[4-amino-2-oxo-5-(2,4,5-trifluorophenyl)pentyl]cyclohexyl]methyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 163421218) has the molecular formula C19H24F6N2O3S and a molecular weight of 474.47 g/mol. Its IUPAC name is N-[[(1R,3R)-3-[4-amino-2-oxo-5-(2,4,5-trifluorophenyl)pentyl]cyclohexyl]methyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[[(1R,3R)-3-[4-amino-2-oxo-5-(2,4,5-trifluorophenyl)pentyl]cyclohexyl]methyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 163421218 |
| Molecular Formula | C19H24F6N2O3S |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[[(1R,3R)-3-[4-amino-2-oxo-5-(2,4,5-trifluorophenyl)pentyl]cyclohexyl]methyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | NC(CC(=O)C[C@@H]1CCC[C@@H](CNS(=O)(=O)C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H24F6N2O3S/c20-16-9-18(22)17(21)7-13(16)6-14(26)8-15(28)5-11-2-1-3-12(4-11)10-27-31(29,30)19(23,24)25/h7,9,11-12,14,27H,1-6,8,10,26H2/t11-,12-,14?/m1/s1 |
| InChIKey | AIPJIQDOIIGGQJ-QAYQGLBKSA-N |
| XLogP | 3.57 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|