C39H58Cl2N6O7 — CID 163421723
tert-butyl N-[7-(4-amino-2-chlorophenyl)-7-azaspiro[3.5]nonan-2-yl]carbamate;tert-butyl N-[7-(2-chloro-4-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl]carbamate;methanol (PubChem CID 163421723) has the molecular formula C39H58Cl2N6O7 and a molecular weight of 793.83 g/mol. Its IUPAC name is tert-butyl N-[7-(4-amino-2-chlorophenyl)-7-azaspiro[3.5]nonan-2-yl]carbamate;tert-butyl N-[7-(2-chloro-4-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl]carbamate;methanol.
| Compound Name | tert-butyl N-[7-(4-amino-2-chlorophenyl)-7-azaspiro[3.5]nonan-2-yl]carbamate;tert-butyl N-[7-(2-chloro-4-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl]carbamate;methanol |
|---|---|
| PubChem CID | 163421723 |
| Molecular Formula | C39H58Cl2N6O7 |
| Molecular Weight | 793.83 g/mol |
| Exact Mass | 792.37 |
| IUPAC Name | tert-butyl N-[7-(4-amino-2-chlorophenyl)-7-azaspiro[3.5]nonan-2-yl]carbamate;tert-butyl N-[7-(2-chloro-4-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl]carbamate;methanol |
| SMILES | CC(C)(C)OC(=O)NC1CC2(CCN(c3ccc(N)cc3Cl)CC2)C1.CC(C)(C)OC(=O)NC1CC2(CCN(c3ccc([N+](=O)[O-])cc3Cl)CC2)C1.CO |
| InChI | InChI=1S/C19H26ClN3O4.C19H28ClN3O2.CH4O/c1-18(2,3)27-17(24)21-13-11-19(12-13)6-8-22(9-7-19)16-5-4-14(23(25)26)10-15(16)20;1-18(2,3)25-17(24)22-14-11-19(12-14)6-8-23(9-7-19)16-5-4-13(21)10-15(16)20;1-2/h4-5,10,13H,6-9,11-12H2,1-3H3,(H,21,24);4-5,10,14H,6-9,11-12,21H2,1-3H3,(H,22,24);2H,1H3 |
| InChIKey | AIZQEZLTYBRGSY-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 172.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.83 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|