C20H30F3NO2 — CID 163422090
(4S,6E)-3-methylidene-N-[2-[(2E)-2-methylpenta-2,4-dienoxy]ethyl]-6-(trifluoromethoxy)deca-6,9-dien-4-amine (PubChem CID 163422090) has the molecular formula C20H30F3NO2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (4S,6E)-3-methylidene-N-[2-[(2E)-2-methylpenta-2,4-dienoxy]ethyl]-6-(trifluoromethoxy)deca-6,9-dien-4-amine.
| Compound Name | (4S,6E)-3-methylidene-N-[2-[(2E)-2-methylpenta-2,4-dienoxy]ethyl]-6-(trifluoromethoxy)deca-6,9-dien-4-amine |
|---|---|
| PubChem CID | 163422090 |
| Molecular Formula | C20H30F3NO2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | (4S,6E)-3-methylidene-N-[2-[(2E)-2-methylpenta-2,4-dienoxy]ethyl]-6-(trifluoromethoxy)deca-6,9-dien-4-amine |
| SMILES | C=C/C=C(\C)COCCN[C@@H](C/C(=C\CC=C)OC(F)(F)F)C(=C)CC |
| InChI | InChI=1S/C20H30F3NO2/c1-6-9-11-18(26-20(21,22)23)14-19(17(5)8-3)24-12-13-25-15-16(4)10-7-2/h6-7,10-11,19,24H,1-2,5,8-9,12-15H2,3-4H3/b16-10+,18-11+/t19-/m0/s1 |
| InChIKey | AJHQKOHVQRHGIO-FQSMUMAASA-N |
| XLogP | 5.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|