About ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol
ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol (PubChem CID 163422214) has the molecular formula C12H12N4O2S
and a molecular weight of 276.32 g/mol. Its IUPAC name is ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol |
| PubChem CID | 163422214 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol |
| SMILES | CCOC(O)c1nc(-c2cnc3cccnn23)cs1 |
| InChI | InChI=1S/C12H12N4O2S/c1-2-18-12(17)11-15-8(7-19-11)9-6-13-10-4-3-5-14-16(9)10/h3-7,12,17H,2H2,1H3 |
| InChIKey | AJKIHMZGMYZZON-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol?
The IUPAC name of ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol (CID 163422214) is ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol.
What is the SMILES notation for ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol?
The canonical SMILES for ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol is CCOC(O)c1nc(-c2cnc3cccnn23)cs1.
What is the InChIKey of ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol?
The InChIKey is AJKIHMZGMYZZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2S/c1-2-18-12(17)11-15-8(7-19-11)9-6-13-10-4-3-5-14-16(9)10/h3-7,12,17H,2H2,1H3.
What are the key properties of ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol?
ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol has a molecular weight of 276.32 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy-(4-imidazo[1,2-b]pyridazin-3-yl-1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 163422214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).