About [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate
[3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate (PubChem CID 163422405) has the molecular formula C22H24O6
and a molecular weight of 384.43 g/mol. Its IUPAC name is [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate.
Molecular Properties
| Compound Name | [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate |
| PubChem CID | 163422405 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate |
| SMILES | C=C(C)C(=O)OC12CC(C)(OC(=O)c3ccccc3)CC3(C1)CC3(OC=O)C2 |
| InChI | InChI=1S/C22H24O6/c1-15(2)17(24)28-21-10-19(3,27-18(25)16-7-5-4-6-8-16)9-20(11-21)12-22(20,13-21)26-14-23/h4-8,14H,1,9-13H2,2-3H3 |
| InChIKey | PBFQMMOOHOLDHY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate?
The IUPAC name of [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate (CID 163422405) is [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate.
What is the SMILES notation for [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate?
The canonical SMILES for [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate is C=C(C)C(=O)OC12CC(C)(OC(=O)c3ccccc3)CC3(C1)CC3(OC=O)C2.
What is the InChIKey of [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate?
The InChIKey is PBFQMMOOHOLDHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O6/c1-15(2)17(24)28-21-10-19(3,27-18(25)16-7-5-4-6-8-16)9-20(11-21)12-22(20,13-21)26-14-23/h4-8,14H,1,9-13H2,2-3H3.
What are the key properties of [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate?
[3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate has a molecular weight of 384.43 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-formyloxy-7-methyl-5-(2-methylprop-2-enoyloxy)-7-tricyclo[3.3.1.01,3]nonanyl] benzoate is sourced from PubChem (CID 163422405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).