C35H37F2NO7 — CID 163422533
6-[4-[(4-aminophenyl)methyl]-3-hydroxyphenyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 163422533) has the molecular formula C35H37F2NO7 and a molecular weight of 621.68 g/mol. Its IUPAC name is 6-[4-[(4-aminophenyl)methyl]-3-hydroxyphenyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | 6-[4-[(4-aminophenyl)methyl]-3-hydroxyphenyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 163422533 |
| Molecular Formula | C35H37F2NO7 |
| Molecular Weight | 621.68 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | 6-[4-[(4-aminophenyl)methyl]-3-hydroxyphenyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CC12C=CC(=O)C=C1C(F)CC1C3CC4OC(c5ccc(Cc6ccc(N)cc6)c(O)c5)OC4(C(=O)CO)C3(C)CC(O)C12F |
| InChI | InChI=1S/C35H37F2NO7/c1-32-10-9-22(40)13-25(32)26(36)14-24-23-15-30-35(29(43)17-39,33(23,2)16-28(42)34(24,32)37)45-31(44-30)20-6-5-19(27(41)12-20)11-18-3-7-21(38)8-4-18/h3-10,12-13,23-24,26,28,30-31,39,41-42H,11,14-17,38H2,1-2H3 |
| InChIKey | AJRCJKOZPZLBPW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|