About 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one
5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one (PubChem CID 163422751) has the molecular formula C20H12F3N3O2
and a molecular weight of 383.33 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one.
Molecular Properties
| Compound Name | 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one |
| PubChem CID | 163422751 |
| Molecular Formula | C20H12F3N3O2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one |
| SMILES | Cc1ccc(Oc2ccc3c(-c4c(F)cccc4F)c(=O)ncn3n2)c(F)c1 |
| InChI | InChI=1S/C20H12F3N3O2/c1-11-5-7-16(14(23)9-11)28-17-8-6-15-19(20(27)24-10-26(15)25-17)18-12(21)3-2-4-13(18)22/h2-10H,1H3 |
| InChIKey | ZTLNETGQZGVYPQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one?
The IUPAC name of 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one (CID 163422751) is 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one.
What is the SMILES notation for 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one?
The canonical SMILES for 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one is Cc1ccc(Oc2ccc3c(-c4c(F)cccc4F)c(=O)ncn3n2)c(F)c1.
What is the InChIKey of 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one?
The InChIKey is ZTLNETGQZGVYPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12F3N3O2/c1-11-5-7-16(14(23)9-11)28-17-8-6-15-19(20(27)24-10-26(15)25-17)18-12(21)3-2-4-13(18)22/h2-10H,1H3.
What are the key properties of 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one?
5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one has a molecular weight of 383.33 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-difluorophenyl)-2-(2-fluoro-4-methylphenoxy)pyrimido[1,6-b]pyridazin-6-one is sourced from PubChem (CID 163422751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).