About 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol
1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol (PubChem CID 163422817) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol |
| PubChem CID | 163422817 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol |
| SMILES | Cc1cc2[nH]c3c(C4=NCCC4)nccc3c2cc1O |
| InChI | InChI=1S/C16H15N3O/c1-9-7-13-11(8-14(9)20)10-4-6-18-16(15(10)19-13)12-3-2-5-17-12/h4,6-8,19-20H,2-3,5H2,1H3 |
| InChIKey | AJXFUBJFRGJFQK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol?
The IUPAC name of 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol (CID 163422817) is 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol?
The canonical SMILES for 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol is Cc1cc2[nH]c3c(C4=NCCC4)nccc3c2cc1O.
What is the InChIKey of 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol?
The InChIKey is AJXFUBJFRGJFQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O/c1-9-7-13-11(8-14(9)20)10-4-6-18-16(15(10)19-13)12-3-2-5-17-12/h4,6-8,19-20H,2-3,5H2,1H3.
What are the key properties of 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol?
1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol has a molecular weight of 265.32 g/mol, XLogP of 3.31, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyrrol-5-yl)-7-methyl-9H-pyrido[3,4-b]indol-6-ol is sourced from PubChem (CID 163422817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).