C16H18ClINOS- — CID 163423796
CID 163423796 (PubChem CID 163423796) has the molecular formula C16H18ClINOS- and a molecular weight of 434.75 g/mol.
| Compound Name | CID 163423796 |
|---|---|
| PubChem CID | 163423796 |
| Molecular Formula | C16H18ClINOS- |
| Molecular Weight | 434.75 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | — |
| SMILES | CNCC1OCCc2sc3cc(Cl)c(C4C[I-]C4)cc3c21 |
| InChI | InChI=1S/C16H18ClINOS/c1-19-8-13-16-11-4-10(9-6-18-7-9)12(17)5-15(11)21-14(16)2-3-20-13/h4-5,9,13,19H,2-3,6-8H2,1H3/q-1 |
| InChIKey | FLRZZPKUHVNSSV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.75 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|