About CID 163423796
CID 163423796 (PubChem CID 163423796) has the molecular formula C16H18ClINOS-
and a molecular weight of 434.75 g/mol.
Molecular Properties
| Compound Name | CID 163423796 |
| PubChem CID | 163423796 |
| Molecular Formula | C16H18ClINOS- |
| Molecular Weight | 434.75 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | — |
| SMILES | CNCC1OCCc2sc3cc(Cl)c(C4C[I-]C4)cc3c21 |
| InChI | InChI=1S/C16H18ClINOS/c1-19-8-13-16-11-4-10(9-6-18-7-9)12(17)5-15(11)21-14(16)2-3-20-13/h4-5,9,13,19H,2-3,6-8H2,1H3/q-1 |
| InChIKey | FLRZZPKUHVNSSV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.75 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163423796 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163423796?
The IUPAC name of CID 163423796 (CID 163423796) is not available.
What is the SMILES notation for CID 163423796?
The canonical SMILES for CID 163423796 is CNCC1OCCc2sc3cc(Cl)c(C4C[I-]C4)cc3c21.
What is the InChIKey of CID 163423796?
The InChIKey is FLRZZPKUHVNSSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClINOS/c1-19-8-13-16-11-4-10(9-6-18-7-9)12(17)5-15(11)21-14(16)2-3-20-13/h4-5,9,13,19H,2-3,6-8H2,1H3/q-1.
What are the key properties of CID 163423796?
CID 163423796 has a molecular weight of 434.75 g/mol, XLogP of 0.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163423796 is sourced from PubChem (CID 163423796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).